C15H16N6O3 — CID 47068528
1-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-3-ethylimidazolidine-2,4,5-trione (PubChem CID 47068528) has the molecular formula C15H16N6O3 and a molecular weight of 328.33 g/mol. Its IUPAC name is 1-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-3-ethylimidazolidine-2,4,5-trione.
| Compound Name | 1-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-3-ethylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 47068528 |
| Molecular Formula | C15H16N6O3 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 1-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-3-ethylimidazolidine-2,4,5-trione |
| SMILES | CCN1C(=O)C(=O)N(Cc2nnnn2-c2c(C)cccc2C)C1=O |
| InChI | InChI=1S/C15H16N6O3/c1-4-19-13(22)14(23)20(15(19)24)8-11-16-17-18-21(11)12-9(2)6-5-7-10(12)3/h5-7H,4,8H2,1-3H3 |
| InChIKey | GPNHZMPABACBJY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|