C15H17N7S — CID 47068541
1-(2,6-dimethylphenyl)-5-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole (PubChem CID 47068541) has the molecular formula C15H17N7S and a molecular weight of 327.42 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-5-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole.
| Compound Name | 1-(2,6-dimethylphenyl)-5-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole |
|---|---|
| PubChem CID | 47068541 |
| Molecular Formula | C15H17N7S |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-5-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole |
| SMILES | C=CCn1cnnc1SCc1nnnn1-c1c(C)cccc1C |
| InChI | InChI=1S/C15H17N7S/c1-4-8-21-10-16-18-15(21)23-9-13-17-19-20-22(13)14-11(2)6-5-7-12(14)3/h4-7,10H,1,8-9H2,2-3H3 |
| InChIKey | FFPZEYLTNZSCRS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|