C14H17N3S — CID 39959102
3-[(3,5-dimethylphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 39959102) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is 3-[(3,5-dimethylphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[(3,5-dimethylphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 39959102 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 3-[(3,5-dimethylphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1cnnc1SCc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C14H17N3S/c1-4-5-17-10-15-16-14(17)18-9-13-7-11(2)6-12(3)8-13/h4,6-8,10H,1,5,9H2,2-3H3 |
| InChIKey | FNJMAZCFYDQFEU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|