C26H26N4 — CID 47069164
2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-4-phenylquinazoline (PubChem CID 47069164) has the molecular formula C26H26N4 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-4-phenylquinazoline.
| Compound Name | 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-4-phenylquinazoline |
|---|---|
| PubChem CID | 47069164 |
| Molecular Formula | C26H26N4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-4-phenylquinazoline |
| SMILES | Cc1ccc(C)c(N2CCN(c3nc(-c4ccccc4)c4ccccc4n3)CC2)c1 |
| InChI | InChI=1S/C26H26N4/c1-19-12-13-20(2)24(18-19)29-14-16-30(17-15-29)26-27-23-11-7-6-10-22(23)25(28-26)21-8-4-3-5-9-21/h3-13,18H,14-17H2,1-2H3 |
| InChIKey | YLRYGMWZTVXVIY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |