C27H28N4O3 — CID 1069557
(1S,6R)-6-[4-(6-methyl-4-phenylquinazolin-2-yl)piperazine-1-carbonyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 1069557) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is (1S,6R)-6-[4-(6-methyl-4-phenylquinazolin-2-yl)piperazine-1-carbonyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[4-(6-methyl-4-phenylquinazolin-2-yl)piperazine-1-carbonyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 1069557 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | (1S,6R)-6-[4-(6-methyl-4-phenylquinazolin-2-yl)piperazine-1-carbonyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | Cc1ccc2nc(N3CCN(C(=O)[C@@H]4CC=CC[C@@H]4C(=O)O)CC3)nc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C27H28N4O3/c1-18-11-12-23-22(17-18)24(19-7-3-2-4-8-19)29-27(28-23)31-15-13-30(14-16-31)25(32)20-9-5-6-10-21(20)26(33)34/h2-8,11-12,17,20-21H,9-10,13-16H2,1H3,(H,33,34)/t20-,21+/m1/s1 |
| InChIKey | VKPOPKZBSRFKMQ-RTWAWAEBSA-N |
| XLogP | 3.92 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|