C27H25BrN4O — CID 4729103
N-(4-bromophenyl)-1-(6-methyl-4-phenylquinazolin-2-yl)piperidine-4-carboxamide (PubChem CID 4729103) has the molecular formula C27H25BrN4O and a molecular weight of 501.43 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-(6-methyl-4-phenylquinazolin-2-yl)piperidine-4-carboxamide.
| Compound Name | N-(4-bromophenyl)-1-(6-methyl-4-phenylquinazolin-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 4729103 |
| Molecular Formula | C27H25BrN4O |
| Molecular Weight | 501.43 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | N-(4-bromophenyl)-1-(6-methyl-4-phenylquinazolin-2-yl)piperidine-4-carboxamide |
| SMILES | Cc1ccc2nc(N3CCC(C(=O)Nc4ccc(Br)cc4)CC3)nc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C27H25BrN4O/c1-18-7-12-24-23(17-18)25(19-5-3-2-4-6-19)31-27(30-24)32-15-13-20(14-16-32)26(33)29-22-10-8-21(28)9-11-22/h2-12,17,20H,13-16H2,1H3,(H,29,33) |
| InChIKey | MJSGZRSIGLXLHE-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.43 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |