C27H27N4O3- — CID 4751818
6-[4-(6-methyl-4-phenylquinazolin-2-yl)piperazine-1-carbonyl]cyclohex-3-ene-1-carboxylate (PubChem CID 4751818) has the molecular formula C27H27N4O3- and a molecular weight of 455.54 g/mol. Its IUPAC name is 6-[4-(6-methyl-4-phenylquinazolin-2-yl)piperazine-1-carbonyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | 6-[4-(6-methyl-4-phenylquinazolin-2-yl)piperazine-1-carbonyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 4751818 |
| Molecular Formula | C27H27N4O3- |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 6-[4-(6-methyl-4-phenylquinazolin-2-yl)piperazine-1-carbonyl]cyclohex-3-ene-1-carboxylate |
| SMILES | Cc1ccc2nc(N3CCN(C(=O)C4CC=CCC4C(=O)[O-])CC3)nc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C27H28N4O3/c1-18-11-12-23-22(17-18)24(19-7-3-2-4-8-19)29-27(28-23)31-15-13-30(14-16-31)25(32)20-9-5-6-10-21(20)26(33)34/h2-8,11-12,17,20-21H,9-10,13-16H2,1H3,(H,33,34)/p-1 |
| InChIKey | VKPOPKZBSRFKMQ-UHFFFAOYSA-M |
| XLogP | 2.59 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|