C17H23N3O4S — CID 47075882
N-(2-butoxyethyl)-2-(1-phenylimidazol-2-yl)sulfonylacetamide (PubChem CID 47075882) has the molecular formula C17H23N3O4S and a molecular weight of 365.45 g/mol. Its IUPAC name is N-(2-butoxyethyl)-2-(1-phenylimidazol-2-yl)sulfonylacetamide.
| Compound Name | N-(2-butoxyethyl)-2-(1-phenylimidazol-2-yl)sulfonylacetamide |
|---|---|
| PubChem CID | 47075882 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-(2-butoxyethyl)-2-(1-phenylimidazol-2-yl)sulfonylacetamide |
| SMILES | CCCCOCCNC(=O)CS(=O)(=O)c1nccn1-c1ccccc1 |
| InChI | InChI=1S/C17H23N3O4S/c1-2-3-12-24-13-10-18-16(21)14-25(22,23)17-19-9-11-20(17)15-7-5-4-6-8-15/h4-9,11H,2-3,10,12-14H2,1H3,(H,18,21) |
| InChIKey | PESWHOQYPDGJMT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|