C21H24N2O6S — CID 47076075
1-(2-nitrophenyl)ethyl 1-(4-methylphenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 47076075) has the molecular formula C21H24N2O6S and a molecular weight of 432.50 g/mol. Its IUPAC name is 1-(2-nitrophenyl)ethyl 1-(4-methylphenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | 1-(2-nitrophenyl)ethyl 1-(4-methylphenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 47076075 |
| Molecular Formula | C21H24N2O6S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 1-(2-nitrophenyl)ethyl 1-(4-methylphenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(C(=O)OC(C)c3ccccc3[N+](=O)[O-])C2)cc1 |
| InChI | InChI=1S/C21H24N2O6S/c1-15-9-11-18(12-10-15)30(27,28)22-13-5-6-17(14-22)21(24)29-16(2)19-7-3-4-8-20(19)23(25)26/h3-4,7-12,16-17H,5-6,13-14H2,1-2H3 |
| InChIKey | IYCLRZZZCYTBAS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|