C12H19Cl2N3O2 — CID 47078407
2-[4-(2,2-dichloro-1-methylcyclopropanecarbonyl)-1,4-diazepan-1-yl]acetamide (PubChem CID 47078407) has the molecular formula C12H19Cl2N3O2 and a molecular weight of 308.21 g/mol. Its IUPAC name is 2-[4-(2,2-dichloro-1-methylcyclopropanecarbonyl)-1,4-diazepan-1-yl]acetamide.
| Compound Name | 2-[4-(2,2-dichloro-1-methylcyclopropanecarbonyl)-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 47078407 |
| Molecular Formula | C12H19Cl2N3O2 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-[4-(2,2-dichloro-1-methylcyclopropanecarbonyl)-1,4-diazepan-1-yl]acetamide |
| SMILES | CC1(C(=O)N2CCCN(CC(N)=O)CC2)CC1(Cl)Cl |
| InChI | InChI=1S/C12H19Cl2N3O2/c1-11(8-12(11,13)14)10(19)17-4-2-3-16(5-6-17)7-9(15)18/h2-8H2,1H3,(H2,15,18) |
| InChIKey | MCQQUICKVYHSRU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|