C17H14F2N4O2 — CID 47081549
1-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-3-(2,4-difluorophenyl)urea (PubChem CID 47081549) has the molecular formula C17H14F2N4O2 and a molecular weight of 344.32 g/mol. Its IUPAC name is 1-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 47081549 |
| Molecular Formula | C17H14F2N4O2 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-3-(2,4-difluorophenyl)urea |
| SMILES | O=C(NCc1nc(Cc2ccccc2)no1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H14F2N4O2/c18-12-6-7-14(13(19)9-12)21-17(24)20-10-16-22-15(23-25-16)8-11-4-2-1-3-5-11/h1-7,9H,8,10H2,(H2,20,21,24) |
| InChIKey | QDYSETUGBYRIMN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |