C24H32N4O4S — CID 47093383
3-(methylsulfamoyl)-N-[1-oxo-1-(3-pyrrolidin-1-ylanilino)hexan-2-yl]benzamide (PubChem CID 47093383) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is 3-(methylsulfamoyl)-N-[1-oxo-1-(3-pyrrolidin-1-ylanilino)hexan-2-yl]benzamide.
| Compound Name | 3-(methylsulfamoyl)-N-[1-oxo-1-(3-pyrrolidin-1-ylanilino)hexan-2-yl]benzamide |
|---|---|
| PubChem CID | 47093383 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 3-(methylsulfamoyl)-N-[1-oxo-1-(3-pyrrolidin-1-ylanilino)hexan-2-yl]benzamide |
| SMILES | CCCCC(NC(=O)c1cccc(S(=O)(=O)NC)c1)C(=O)Nc1cccc(N2CCCC2)c1 |
| InChI | InChI=1S/C24H32N4O4S/c1-3-4-13-22(27-23(29)18-9-7-12-21(16-18)33(31,32)25-2)24(30)26-19-10-8-11-20(17-19)28-14-5-6-15-28/h7-12,16-17,22,25H,3-6,13-15H2,1-2H3,(H,26,30)(H,27,29) |
| InChIKey | YUQMTWQQKFNLTJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |