C25H32FN3O2 — CID 60622642
2-[3-(3-fluorophenyl)propanoylamino]-N-(3-pyrrolidin-1-ylphenyl)hexanamide (PubChem CID 60622642) has the molecular formula C25H32FN3O2 and a molecular weight of 425.55 g/mol. Its IUPAC name is 2-[3-(3-fluorophenyl)propanoylamino]-N-(3-pyrrolidin-1-ylphenyl)hexanamide.
| Compound Name | 2-[3-(3-fluorophenyl)propanoylamino]-N-(3-pyrrolidin-1-ylphenyl)hexanamide |
|---|---|
| PubChem CID | 60622642 |
| Molecular Formula | C25H32FN3O2 |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 2-[3-(3-fluorophenyl)propanoylamino]-N-(3-pyrrolidin-1-ylphenyl)hexanamide |
| SMILES | CCCCC(NC(=O)CCc1cccc(F)c1)C(=O)Nc1cccc(N2CCCC2)c1 |
| InChI | InChI=1S/C25H32FN3O2/c1-2-3-12-23(28-24(30)14-13-19-8-6-9-20(26)17-19)25(31)27-21-10-7-11-22(18-21)29-15-4-5-16-29/h6-11,17-18,23H,2-5,12-16H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | WMZKISTWLQDHLL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |