C28H32N4O3 — CID 60622370
2-oxo-N-[1-oxo-1-(3-pyrrolidin-1-ylanilino)hexan-2-yl]-6-phenyl-1H-pyridine-3-carboxamide (PubChem CID 60622370) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is 2-oxo-N-[1-oxo-1-(3-pyrrolidin-1-ylanilino)hexan-2-yl]-6-phenyl-1H-pyridine-3-carboxamide.
| Compound Name | 2-oxo-N-[1-oxo-1-(3-pyrrolidin-1-ylanilino)hexan-2-yl]-6-phenyl-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60622370 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 2-oxo-N-[1-oxo-1-(3-pyrrolidin-1-ylanilino)hexan-2-yl]-6-phenyl-1H-pyridine-3-carboxamide |
| SMILES | CCCCC(NC(=O)c1ccc(-c2ccccc2)[nH]c1=O)C(=O)Nc1cccc(N2CCCC2)c1 |
| InChI | InChI=1S/C28H32N4O3/c1-2-3-14-25(28(35)29-21-12-9-13-22(19-21)32-17-7-8-18-32)31-27(34)23-15-16-24(30-26(23)33)20-10-5-4-6-11-20/h4-6,9-13,15-16,19,25H,2-3,7-8,14,17-18H2,1H3,(H,29,35)(H,30,33)(H,31,34) |
| InChIKey | SOHZMLTUDXWXTL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |