C23H14Cl2N2O4 — CID 4709886
1-[5-(3,4-dichlorophenyl)furan-2-yl]-3-[1-(4-nitrophenyl)pyrrol-2-yl]prop-2-en-1-one (PubChem CID 4709886) has the molecular formula C23H14Cl2N2O4 and a molecular weight of 453.28 g/mol. Its IUPAC name is 1-[5-(3,4-dichlorophenyl)furan-2-yl]-3-[1-(4-nitrophenyl)pyrrol-2-yl]prop-2-en-1-one.
| Compound Name | 1-[5-(3,4-dichlorophenyl)furan-2-yl]-3-[1-(4-nitrophenyl)pyrrol-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 4709886 |
| Molecular Formula | C23H14Cl2N2O4 |
| Molecular Weight | 453.28 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | 1-[5-(3,4-dichlorophenyl)furan-2-yl]-3-[1-(4-nitrophenyl)pyrrol-2-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1cccn1-c1ccc([N+](=O)[O-])cc1)c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C23H14Cl2N2O4/c24-19-9-3-15(14-20(19)25)22-11-12-23(31-22)21(28)10-8-16-2-1-13-26(16)17-4-6-18(7-5-17)27(29)30/h1-14H |
| InChIKey | WZVUPDZGMAGVBH-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 78.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.28 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|