C12H14N2O5S — CID 47103900
methyl 2-(3-oxopiperazin-1-yl)sulfonylbenzoate (PubChem CID 47103900) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is methyl 2-(3-oxopiperazin-1-yl)sulfonylbenzoate.
| Compound Name | methyl 2-(3-oxopiperazin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 47103900 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | methyl 2-(3-oxopiperazin-1-yl)sulfonylbenzoate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/C12H14N2O5S/c1-19-12(16)9-4-2-3-5-10(9)20(17,18)14-7-6-13-11(15)8-14/h2-5H,6-8H2,1H3,(H,13,15) |
| InChIKey | UXWJHJYSUPDWPO-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |