C14H19N5O — CID 47128145
1-methyl-1-[(1-methylpyrazol-4-yl)methyl]-3-(2-pyridin-2-ylethyl)urea (PubChem CID 47128145) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-methyl-1-[(1-methylpyrazol-4-yl)methyl]-3-(2-pyridin-2-ylethyl)urea.
| Compound Name | 1-methyl-1-[(1-methylpyrazol-4-yl)methyl]-3-(2-pyridin-2-ylethyl)urea |
|---|---|
| PubChem CID | 47128145 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 1-methyl-1-[(1-methylpyrazol-4-yl)methyl]-3-(2-pyridin-2-ylethyl)urea |
| SMILES | CN(Cc1cnn(C)c1)C(=O)NCCc1ccccn1 |
| InChI | InChI=1S/C14H19N5O/c1-18(10-12-9-17-19(2)11-12)14(20)16-8-6-13-5-3-4-7-15-13/h3-5,7,9,11H,6,8,10H2,1-2H3,(H,16,20) |
| InChIKey | INTOQZCOXPZUTN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |