C20H21FN4O3S — CID 4713298
3-(2-amino-3-propylsulfonylbenzimidazol-5-yl)-3-(3-fluorophenyl)-N-methylprop-2-enamide (PubChem CID 4713298) has the molecular formula C20H21FN4O3S and a molecular weight of 416.48 g/mol. Its IUPAC name is 3-(2-amino-3-propylsulfonylbenzimidazol-5-yl)-3-(3-fluorophenyl)-N-methylprop-2-enamide.
| Compound Name | 3-(2-amino-3-propylsulfonylbenzimidazol-5-yl)-3-(3-fluorophenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 4713298 |
| Molecular Formula | C20H21FN4O3S |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 3-(2-amino-3-propylsulfonylbenzimidazol-5-yl)-3-(3-fluorophenyl)-N-methylprop-2-enamide |
| SMILES | CCCS(=O)(=O)n1c(N)nc2ccc(C(=CC(=O)NC)c3cccc(F)c3)cc21 |
| InChI | InChI=1S/C20H21FN4O3S/c1-3-9-29(27,28)25-18-11-14(7-8-17(18)24-20(25)22)16(12-19(26)23-2)13-5-4-6-15(21)10-13/h4-8,10-12H,3,9H2,1-2H3,(H2,22,24)(H,23,26) |
| InChIKey | RMGAIFYKOIAXHO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|