C35H26N2S2 — CID 4714513
2-(2-phenylethenyl)-4,5-bis(4-phenylsulfanylphenyl)-1H-imidazole (PubChem CID 4714513) has the molecular formula C35H26N2S2 and a molecular weight of 538.74 g/mol. Its IUPAC name is 2-(2-phenylethenyl)-4,5-bis(4-phenylsulfanylphenyl)-1H-imidazole.
| Compound Name | 2-(2-phenylethenyl)-4,5-bis(4-phenylsulfanylphenyl)-1H-imidazole |
|---|---|
| PubChem CID | 4714513 |
| Molecular Formula | C35H26N2S2 |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 2-(2-phenylethenyl)-4,5-bis(4-phenylsulfanylphenyl)-1H-imidazole |
| SMILES | C(=Cc1nc(-c2ccc(Sc3ccccc3)cc2)c(-c2ccc(Sc3ccccc3)cc2)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C35H26N2S2/c1-4-10-26(11-5-1)16-25-33-36-34(27-17-21-31(22-18-27)38-29-12-6-2-7-13-29)35(37-33)28-19-23-32(24-20-28)39-30-14-8-3-9-15-30/h1-25H,(H,36,37) |
| InChIKey | MDYXGDSVFFDLTJ-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |