C16H18BrN3O3 — CID 4717802
N-[(5-bromo-2-methoxyphenyl)methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine (PubChem CID 4717802) has the molecular formula C16H18BrN3O3 and a molecular weight of 380.24 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 4717802 |
| Molecular Formula | C16H18BrN3O3 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine |
| SMILES | COc1ccc(Br)cc1CNCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H18BrN3O3/c1-23-16-7-2-13(17)10-12(16)11-18-8-9-19-14-3-5-15(6-4-14)20(21)22/h2-7,10,18-19H,8-9,11H2,1H3 |
| InChIKey | WNZWQDWCQJWUJT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|