C12H21N3O2S — CID 47194230
1-[3-(2-methylpropoxy)propyl]-3-(4-methyl-1,3-thiazol-2-yl)urea (PubChem CID 47194230) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is 1-[3-(2-methylpropoxy)propyl]-3-(4-methyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-[3-(2-methylpropoxy)propyl]-3-(4-methyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 47194230 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-[3-(2-methylpropoxy)propyl]-3-(4-methyl-1,3-thiazol-2-yl)urea |
| SMILES | Cc1csc(NC(=O)NCCCOCC(C)C)n1 |
| InChI | InChI=1S/C12H21N3O2S/c1-9(2)7-17-6-4-5-13-11(16)15-12-14-10(3)8-18-12/h8-9H,4-7H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | BKVLVLOSCTVKJW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|