C11H19N3S2 — CID 19703595
1-(4-methylpentyl)-3-(4-methyl-1,3-thiazol-2-yl)thiourea (PubChem CID 19703595) has the molecular formula C11H19N3S2 and a molecular weight of 257.43 g/mol. Its IUPAC name is 1-(4-methylpentyl)-3-(4-methyl-1,3-thiazol-2-yl)thiourea.
| Compound Name | 1-(4-methylpentyl)-3-(4-methyl-1,3-thiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 19703595 |
| Molecular Formula | C11H19N3S2 |
| Molecular Weight | 257.43 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 1-(4-methylpentyl)-3-(4-methyl-1,3-thiazol-2-yl)thiourea |
| SMILES | Cc1csc(NC(=S)NCCCC(C)C)n1 |
| InChI | InChI=1S/C11H19N3S2/c1-8(2)5-4-6-12-10(15)14-11-13-9(3)7-16-11/h7-8H,4-6H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | ZXBRVBHGJUHSAO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|