C15H20N2O3 — CID 47220201
N-(1,3-benzodioxol-5-yl)-3-[cyclopropyl(ethyl)amino]propanamide (PubChem CID 47220201) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-[cyclopropyl(ethyl)amino]propanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-[cyclopropyl(ethyl)amino]propanamide |
|---|---|
| PubChem CID | 47220201 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-[cyclopropyl(ethyl)amino]propanamide |
| SMILES | CCN(CCC(=O)Nc1ccc2c(c1)OCO2)C1CC1 |
| InChI | InChI=1S/C15H20N2O3/c1-2-17(12-4-5-12)8-7-15(18)16-11-3-6-13-14(9-11)20-10-19-13/h3,6,9,12H,2,4-5,7-8,10H2,1H3,(H,16,18) |
| InChIKey | NVAREYRTFWFRHC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |