C12H17N5 — CID 4725629
N-[(2-methylphenyl)methyl]-1-propyltetrazol-5-amine (PubChem CID 4725629) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is N-[(2-methylphenyl)methyl]-1-propyltetrazol-5-amine.
| Compound Name | N-[(2-methylphenyl)methyl]-1-propyltetrazol-5-amine |
|---|---|
| PubChem CID | 4725629 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | N-[(2-methylphenyl)methyl]-1-propyltetrazol-5-amine |
| SMILES | CCCn1nnnc1NCc1ccccc1C |
| InChI | InChI=1S/C12H17N5/c1-3-8-17-12(14-15-16-17)13-9-11-7-5-4-6-10(11)2/h4-7H,3,8-9H2,1-2H3,(H,13,14,16) |
| InChIKey | FHUBMNIOCZIWMP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |