About 2,3-dimethyl-N-[(2-methylphenyl)methyl]-1-propylpyrrolo[2,3-c]pyridin-7-amine
2,3-dimethyl-N-[(2-methylphenyl)methyl]-1-propylpyrrolo[2,3-c]pyridin-7-amine (PubChem CID 67141915) has the molecular formula C20H25N3
and a molecular weight of 307.44 g/mol. Its IUPAC name is 2,3-dimethyl-N-[(2-methylphenyl)methyl]-1-propylpyrrolo[2,3-c]pyridin-7-amine.
Molecular Properties
| Compound Name | 2,3-dimethyl-N-[(2-methylphenyl)methyl]-1-propylpyrrolo[2,3-c]pyridin-7-amine |
| PubChem CID | 67141915 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 2,3-dimethyl-N-[(2-methylphenyl)methyl]-1-propylpyrrolo[2,3-c]pyridin-7-amine |
| SMILES | CCCn1c(C)c(C)c2ccnc(NCc3ccccc3C)c21 |
| InChI | InChI=1S/C20H25N3/c1-5-12-23-16(4)15(3)18-10-11-21-20(19(18)23)22-13-17-9-7-6-8-14(17)2/h6-11H,5,12-13H2,1-4H3,(H,21,22) |
| InChIKey | VNUMBZUERSTWER-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dimethyl-N-[(2-methylphenyl)methyl]-1-propylpyrrolo[2,3-c]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-N-[(2-methylphenyl)methyl]-1-propylpyrrolo[2,3-c]pyridin-7-amine?
The IUPAC name of 2,3-dimethyl-N-[(2-methylphenyl)methyl]-1-propylpyrrolo[2,3-c]pyridin-7-amine (CID 67141915) is 2,3-dimethyl-N-[(2-methylphenyl)methyl]-1-propylpyrrolo[2,3-c]pyridin-7-amine.
What is the SMILES notation for 2,3-dimethyl-N-[(2-methylphenyl)methyl]-1-propylpyrrolo[2,3-c]pyridin-7-amine?
The canonical SMILES for 2,3-dimethyl-N-[(2-methylphenyl)methyl]-1-propylpyrrolo[2,3-c]pyridin-7-amine is CCCn1c(C)c(C)c2ccnc(NCc3ccccc3C)c21.
What is the InChIKey of 2,3-dimethyl-N-[(2-methylphenyl)methyl]-1-propylpyrrolo[2,3-c]pyridin-7-amine?
The InChIKey is VNUMBZUERSTWER-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3/c1-5-12-23-16(4)15(3)18-10-11-21-20(19(18)23)22-13-17-9-7-6-8-14(17)2/h6-11H,5,12-13H2,1-4H3,(H,21,22).
What are the key properties of 2,3-dimethyl-N-[(2-methylphenyl)methyl]-1-propylpyrrolo[2,3-c]pyridin-7-amine?
2,3-dimethyl-N-[(2-methylphenyl)methyl]-1-propylpyrrolo[2,3-c]pyridin-7-amine has a molecular weight of 307.44 g/mol, XLogP of 4.98, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-N-[(2-methylphenyl)methyl]-1-propylpyrrolo[2,3-c]pyridin-7-amine is sourced from PubChem (CID 67141915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).