C20H24ClN3 — CID 67142843
N-benzyl-1-but-3-enyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine;hydrochloride (PubChem CID 67142843) has the molecular formula C20H24ClN3 and a molecular weight of 341.89 g/mol. Its IUPAC name is N-benzyl-1-but-3-enyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine;hydrochloride.
| Compound Name | N-benzyl-1-but-3-enyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine;hydrochloride |
|---|---|
| PubChem CID | 67142843 |
| Molecular Formula | C20H24ClN3 |
| Molecular Weight | 341.89 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-benzyl-1-but-3-enyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine;hydrochloride |
| SMILES | C=CCCn1c(C)c(C)c2ccnc(NCc3ccccc3)c21.Cl |
| InChI | InChI=1S/C20H23N3.ClH/c1-4-5-13-23-16(3)15(2)18-11-12-21-20(19(18)23)22-14-17-9-7-6-8-10-17;/h4,6-12H,1,5,13-14H2,2-3H3,(H,21,22);1H |
| InChIKey | FTDASDLLHMOIPD-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.89 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|