C20H23N3O — CID 87392794
2-methyl-7-[(2-methylphenyl)methylamino]-1-propylpyrrolo[2,3-c]pyridine-3-carbaldehyde (PubChem CID 87392794) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-methyl-7-[(2-methylphenyl)methylamino]-1-propylpyrrolo[2,3-c]pyridine-3-carbaldehyde.
| Compound Name | 2-methyl-7-[(2-methylphenyl)methylamino]-1-propylpyrrolo[2,3-c]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 87392794 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 2-methyl-7-[(2-methylphenyl)methylamino]-1-propylpyrrolo[2,3-c]pyridine-3-carbaldehyde |
| SMILES | CCCn1c(C)c(C=O)c2ccnc(NCc3ccccc3C)c21 |
| InChI | InChI=1S/C20H23N3O/c1-4-11-23-15(3)18(13-24)17-9-10-21-20(19(17)23)22-12-16-8-6-5-7-14(16)2/h5-10,13H,4,11-12H2,1-3H3,(H,21,22) |
| InChIKey | QMJMLSJAESTCGR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|