C7H9N3O3S — CID 47257748
ethyl 2-(1,2,5-thiadiazole-3-carbonylamino)acetate (PubChem CID 47257748) has the molecular formula C7H9N3O3S and a molecular weight of 215.23 g/mol. Its IUPAC name is ethyl 2-(1,2,5-thiadiazole-3-carbonylamino)acetate.
| Compound Name | ethyl 2-(1,2,5-thiadiazole-3-carbonylamino)acetate |
|---|---|
| PubChem CID | 47257748 |
| Molecular Formula | C7H9N3O3S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | ethyl 2-(1,2,5-thiadiazole-3-carbonylamino)acetate |
| SMILES | CCOC(=O)CNC(=O)c1cnsn1 |
| InChI | InChI=1S/C7H9N3O3S/c1-2-13-6(11)4-8-7(12)5-3-9-14-10-5/h3H,2,4H2,1H3,(H,8,12) |
| InChIKey | ARZVCMUEWKEQGH-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |