About 2-methoxy-3-(1,2,5-thiadiazole-3-carbonylamino)propanoic acid
2-methoxy-3-(1,2,5-thiadiazole-3-carbonylamino)propanoic acid (PubChem CID 106107261) has the molecular formula C7H9N3O4S
and a molecular weight of 231.23 g/mol. Its IUPAC name is 2-methoxy-3-(1,2,5-thiadiazole-3-carbonylamino)propanoic acid.
Analyze 2-methoxy-3-(1,2,5-thiadiazole-3-carbonylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3-(1,2,5-thiadiazole-3-carbonylamino)propanoic acid?
The IUPAC name of 2-methoxy-3-(1,2,5-thiadiazole-3-carbonylamino)propanoic acid (CID 106107261) is 2-methoxy-3-(1,2,5-thiadiazole-3-carbonylamino)propanoic acid.
What is the SMILES notation for 2-methoxy-3-(1,2,5-thiadiazole-3-carbonylamino)propanoic acid?
The canonical SMILES for 2-methoxy-3-(1,2,5-thiadiazole-3-carbonylamino)propanoic acid is COC(CNC(=O)c1cnsn1)C(=O)O.
What is the InChIKey of 2-methoxy-3-(1,2,5-thiadiazole-3-carbonylamino)propanoic acid?
The InChIKey is LLDLPFWQUBDCJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O4S/c1-14-5(7(12)13)3-8-6(11)4-2-9-15-10-4/h2,5H,3H2,1H3,(H,8,11)(H,12,13).
What are the key properties of 2-methoxy-3-(1,2,5-thiadiazole-3-carbonylamino)propanoic acid?
2-methoxy-3-(1,2,5-thiadiazole-3-carbonylamino)propanoic acid has a molecular weight of 231.23 g/mol, XLogP of -0.63, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3-(1,2,5-thiadiazole-3-carbonylamino)propanoic acid is sourced from PubChem (CID 106107261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).