C8H11N3O2S — CID 91648581
N-(3-methyl-2-oxobutyl)-1,2,5-thiadiazole-3-carboxamide (PubChem CID 91648581) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is N-(3-methyl-2-oxobutyl)-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | N-(3-methyl-2-oxobutyl)-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 91648581 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | N-(3-methyl-2-oxobutyl)-1,2,5-thiadiazole-3-carboxamide |
| SMILES | CC(C)C(=O)CNC(=O)c1cnsn1 |
| InChI | InChI=1S/C8H11N3O2S/c1-5(2)7(12)4-9-8(13)6-3-10-14-11-6/h3,5H,4H2,1-2H3,(H,9,13) |
| InChIKey | DAIBLINPOURQLF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |