2-[(1,2,5-thiadiazole-3-carbonylamino)methyl]pentanoic acid

C9H13N3O3S — CID 65219482

IUPAC2-[(1,2,5-thiadiazole-3-carbonylamino)methyl]pentanoic acid
SMILESCCCC(CNC(=O)c1cnsn1)C(=O)O
InChIInChI=1S/C9H13N3O3S/c1-2-3-6(9(14)15)4-10-8(13)7-5-11-16-12-7/h5-6H,2-4H2,1H3,(H,10,13)(H,14,15)
InChIKeyLXNABZMMIZHKEN-UHFFFAOYSA-N
MW243.29 g/mol
LogP0.77
Rot. Bonds6

About 2-[(1,2,5-thiadiazole-3-carbonylamino)methyl]pentanoic acid

2-[(1,2,5-thiadiazole-3-carbonylamino)methyl]pentanoic acid (PubChem CID 65219482) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-[(1,2,5-thiadiazole-3-carbonylamino)methyl]pentanoic acid.

Molecular Properties

Compound Name2-[(1,2,5-thiadiazole-3-carbonylamino)methyl]pentanoic acid
PubChem CID65219482
Molecular FormulaC9H13N3O3S
Molecular Weight243.29 g/mol
Exact Mass243.07
IUPAC Name2-[(1,2,5-thiadiazole-3-carbonylamino)methyl]pentanoic acid
SMILESCCCC(CNC(=O)c1cnsn1)C(=O)O
InChIInChI=1S/C9H13N3O3S/c1-2-3-6(9(14)15)4-10-8(13)7-5-11-16-12-7/h5-6H,2-4H2,1H3,(H,10,13)(H,14,15)
InChIKeyLXNABZMMIZHKEN-UHFFFAOYSA-N
XLogP0.77
TPSA92.18 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.29
LogP ≤ 50.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[(1,2,5-thiadiazole-3-carbonylamino)methyl]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1,2,5-thiadiazole-3-carbonylamino)methyl]pentanoic acid?
The IUPAC name of 2-[(1,2,5-thiadiazole-3-carbonylamino)methyl]pentanoic acid (CID 65219482) is 2-[(1,2,5-thiadiazole-3-carbonylamino)methyl]pentanoic acid.
What is the SMILES notation for 2-[(1,2,5-thiadiazole-3-carbonylamino)methyl]pentanoic acid?
The canonical SMILES for 2-[(1,2,5-thiadiazole-3-carbonylamino)methyl]pentanoic acid is CCCC(CNC(=O)c1cnsn1)C(=O)O.
What is the InChIKey of 2-[(1,2,5-thiadiazole-3-carbonylamino)methyl]pentanoic acid?
The InChIKey is LXNABZMMIZHKEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O3S/c1-2-3-6(9(14)15)4-10-8(13)7-5-11-16-12-7/h5-6H,2-4H2,1H3,(H,10,13)(H,14,15).
What are the key properties of 2-[(1,2,5-thiadiazole-3-carbonylamino)methyl]pentanoic acid?
2-[(1,2,5-thiadiazole-3-carbonylamino)methyl]pentanoic acid has a molecular weight of 243.29 g/mol, XLogP of 0.77, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,2,5-thiadiazole-3-carbonylamino)methyl]pentanoic acid is sourced from PubChem (CID 65219482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).