C10H13N5O2 — CID 47267179
1-(1-ethylpyrazol-4-yl)-3-(5-methyl-1,2-oxazol-3-yl)urea (PubChem CID 47267179) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 1-(1-ethylpyrazol-4-yl)-3-(5-methyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-(1-ethylpyrazol-4-yl)-3-(5-methyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 47267179 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 1-(1-ethylpyrazol-4-yl)-3-(5-methyl-1,2-oxazol-3-yl)urea |
| SMILES | CCn1cc(NC(=O)Nc2cc(C)on2)cn1 |
| InChI | InChI=1S/C10H13N5O2/c1-3-15-6-8(5-11-15)12-10(16)13-9-4-7(2)17-14-9/h4-6H,3H2,1-2H3,(H2,12,13,14,16) |
| InChIKey | NSQZDRHLIRNCFX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |