C11H11F3N4S — CID 4726735
3-methyl-4-[[2-(trifluoromethyl)phenyl]methylamino]-1H-1,2,4-triazole-5-thione (PubChem CID 4726735) has the molecular formula C11H11F3N4S and a molecular weight of 288.30 g/mol. Its IUPAC name is 3-methyl-4-[[2-(trifluoromethyl)phenyl]methylamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-methyl-4-[[2-(trifluoromethyl)phenyl]methylamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4726735 |
| Molecular Formula | C11H11F3N4S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 3-methyl-4-[[2-(trifluoromethyl)phenyl]methylamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1n[nH]c(=S)n1NCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H11F3N4S/c1-7-16-17-10(19)18(7)15-6-8-4-2-3-5-9(8)11(12,13)14/h2-5,15H,6H2,1H3,(H,17,19) |
| InChIKey | PIEPRSMMDFORCD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|