C8H13N3O3S — CID 47267519
N-(oxolan-2-ylmethyl)-1H-pyrazole-4-sulfonamide (PubChem CID 47267519) has the molecular formula C8H13N3O3S and a molecular weight of 231.28 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(oxolan-2-ylmethyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 47267519 |
| Molecular Formula | C8H13N3O3S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(NCC1CCCO1)c1cn[nH]c1 |
| InChI | InChI=1S/C8H13N3O3S/c12-15(13,8-5-9-10-6-8)11-4-7-2-1-3-14-7/h5-7,11H,1-4H2,(H,9,10) |
| InChIKey | QWYSQVRRDAFWTE-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |