C7H11N3O3S — CID 91059253
N-[(3S)-oxolan-3-yl]-1H-pyrazole-4-sulfonamide (PubChem CID 91059253) has the molecular formula C7H11N3O3S and a molecular weight of 217.25 g/mol. Its IUPAC name is N-[(3S)-oxolan-3-yl]-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[(3S)-oxolan-3-yl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 91059253 |
| Molecular Formula | C7H11N3O3S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | N-[(3S)-oxolan-3-yl]-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(N[C@H]1CCOC1)c1cn[nH]c1 |
| InChI | InChI=1S/C7H11N3O3S/c11-14(12,7-3-8-9-4-7)10-6-1-2-13-5-6/h3-4,6,10H,1-2,5H2,(H,8,9)/t6-/m0/s1 |
| InChIKey | KFZOBBGCYOXYFB-LURJTMIESA-N |
| XLogP | -0.52 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |