C20H16Cl2N4O2S — CID 4726921
4-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-3-(2-methoxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 4726921) has the molecular formula C20H16Cl2N4O2S and a molecular weight of 447.35 g/mol. Its IUPAC name is 4-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-3-(2-methoxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-3-(2-methoxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4726921 |
| Molecular Formula | C20H16Cl2N4O2S |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 4-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-3-(2-methoxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccccc1-c1n[nH]c(=S)n1NCc1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C20H16Cl2N4O2S/c1-27-17-5-3-2-4-14(17)19-24-25-20(29)26(19)23-11-13-7-9-18(28-13)15-10-12(21)6-8-16(15)22/h2-10,23H,11H2,1H3,(H,25,29) |
| InChIKey | FLCBTSSUXKMKHN-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|