C11H11N5O3S — CID 47283649
N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-(3-nitropyrazol-1-yl)acetamide (PubChem CID 47283649) has the molecular formula C11H11N5O3S and a molecular weight of 293.31 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-(3-nitropyrazol-1-yl)acetamide.
| Compound Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-(3-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 47283649 |
| Molecular Formula | C11H11N5O3S |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-(3-nitropyrazol-1-yl)acetamide |
| SMILES | O=C(Cn1ccc([N+](=O)[O-])n1)Nc1nc(C2CC2)cs1 |
| InChI | InChI=1S/C11H11N5O3S/c17-10(5-15-4-3-9(14-15)16(18)19)13-11-12-8(6-20-11)7-1-2-7/h3-4,6-7H,1-2,5H2,(H,12,13,17) |
| InChIKey | RDAZLMRXECBLTQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|