C11H8N2O3S3 — CID 47286188
5-[(5-nitrothiophen-3-yl)methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 47286188) has the molecular formula C11H8N2O3S3 and a molecular weight of 312.40 g/mol. Its IUPAC name is 5-[(5-nitrothiophen-3-yl)methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[(5-nitrothiophen-3-yl)methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 47286188 |
| Molecular Formula | C11H8N2O3S3 |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | 5-[(5-nitrothiophen-3-yl)methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(=Cc2csc([N+](=O)[O-])c2)SC1=S |
| InChI | InChI=1S/C11H8N2O3S3/c1-2-3-12-10(14)8(19-11(12)17)4-7-5-9(13(15)16)18-6-7/h2,4-6H,1,3H2 |
| InChIKey | ALMVINVTGWLBFS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|