C13H8ClN2O4S2- — CID 7031718
4-chloro-2-nitro-6-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenolate (PubChem CID 7031718) has the molecular formula C13H8ClN2O4S2- and a molecular weight of 355.80 g/mol. Its IUPAC name is 4-chloro-2-nitro-6-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenolate.
| Compound Name | 4-chloro-2-nitro-6-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenolate |
|---|---|
| PubChem CID | 7031718 |
| Molecular Formula | C13H8ClN2O4S2- |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 354.96 |
| IUPAC Name | 4-chloro-2-nitro-6-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenolate |
| SMILES | C=CCN1C(=O)C(=Cc2cc(Cl)cc([N+](=O)[O-])c2[O-])SC1=S |
| InChI | InChI=1S/C13H9ClN2O4S2/c1-2-3-15-12(18)10(22-13(15)21)5-7-4-8(14)6-9(11(7)17)16(19)20/h2,4-6,17H,1,3H2/p-1 |
| InChIKey | RUTURBIOEMKCSV-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|