C11H6Cl2FN3O3 — CID 47293660
4,5-dichloro-2-[(5-fluoro-2-nitrophenyl)methyl]pyridazin-3-one (PubChem CID 47293660) has the molecular formula C11H6Cl2FN3O3 and a molecular weight of 318.09 g/mol. Its IUPAC name is 4,5-dichloro-2-[(5-fluoro-2-nitrophenyl)methyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[(5-fluoro-2-nitrophenyl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 47293660 |
| Molecular Formula | C11H6Cl2FN3O3 |
| Molecular Weight | 318.09 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | 4,5-dichloro-2-[(5-fluoro-2-nitrophenyl)methyl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1Cc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H6Cl2FN3O3/c12-8-4-15-16(11(18)10(8)13)5-6-3-7(14)1-2-9(6)17(19)20/h1-4H,5H2 |
| InChIKey | AZNAUVZEZZQIDN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.09 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|