C13H11BrClN3O3S — CID 4730098
N'-[(5-bromo-6-chloro-3-pyridinyl)sulfonyl]-2-methylbenzohydrazide (PubChem CID 4730098) has the molecular formula C13H11BrClN3O3S and a molecular weight of 404.67 g/mol. Its IUPAC name is N'-[(5-bromo-6-chloro-3-pyridinyl)sulfonyl]-2-methylbenzohydrazide.
| Compound Name | N'-[(5-bromo-6-chloro-3-pyridinyl)sulfonyl]-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 4730098 |
| Molecular Formula | C13H11BrClN3O3S |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 402.94 |
| IUPAC Name | N'-[(5-bromo-6-chloro-3-pyridinyl)sulfonyl]-2-methylbenzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNS(=O)(=O)c1cnc(Cl)c(Br)c1 |
| InChI | InChI=1S/C13H11BrClN3O3S/c1-8-4-2-3-5-10(8)13(19)17-18-22(20,21)9-6-11(14)12(15)16-7-9/h2-7,18H,1H3,(H,17,19) |
| InChIKey | PBERWNICFGVTIG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|