C20H16BrCl2N3O3S — CID 11606192
2-[(5-bromo-6-chloro-3-pyridinyl)sulfonylamino]-5-chloro-N-(1-phenylethyl)benzamide (PubChem CID 11606192) has the molecular formula C20H16BrCl2N3O3S and a molecular weight of 529.24 g/mol. Its IUPAC name is 2-[(5-bromo-6-chloro-3-pyridinyl)sulfonylamino]-5-chloro-N-(1-phenylethyl)benzamide.
| Compound Name | 2-[(5-bromo-6-chloro-3-pyridinyl)sulfonylamino]-5-chloro-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 11606192 |
| Molecular Formula | C20H16BrCl2N3O3S |
| Molecular Weight | 529.24 g/mol |
| Exact Mass | 526.95 |
| IUPAC Name | 2-[(5-bromo-6-chloro-3-pyridinyl)sulfonylamino]-5-chloro-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1cc(Cl)ccc1NS(=O)(=O)c1cnc(Cl)c(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C20H16BrCl2N3O3S/c1-12(13-5-3-2-4-6-13)25-20(27)16-9-14(22)7-8-18(16)26-30(28,29)15-10-17(21)19(23)24-11-15/h2-12,26H,1H3,(H,25,27) |
| InChIKey | VKNRWYXCGGIHFK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.24 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|