C18H15FN2O3S — CID 135298550
2-fluoro-3-methyl-N'-naphthalen-2-ylsulfonylbenzohydrazide (PubChem CID 135298550) has the molecular formula C18H15FN2O3S and a molecular weight of 358.39 g/mol. Its IUPAC name is 2-fluoro-3-methyl-N'-naphthalen-2-ylsulfonylbenzohydrazide.
| Compound Name | 2-fluoro-3-methyl-N'-naphthalen-2-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 135298550 |
| Molecular Formula | C18H15FN2O3S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 2-fluoro-3-methyl-N'-naphthalen-2-ylsulfonylbenzohydrazide |
| SMILES | Cc1cccc(C(=O)NNS(=O)(=O)c2ccc3ccccc3c2)c1F |
| InChI | InChI=1S/C18H15FN2O3S/c1-12-5-4-8-16(17(12)19)18(22)20-21-25(23,24)15-10-9-13-6-2-3-7-14(13)11-15/h2-11,21H,1H3,(H,20,22) |
| InChIKey | DILVLVXPRQTRMP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|