C24H19FN2O3S — CID 134581276
6-fluoro-2-methyl-N'-naphthalen-2-ylsulfonyl-3-phenylbenzohydrazide (PubChem CID 134581276) has the molecular formula C24H19FN2O3S and a molecular weight of 434.49 g/mol. Its IUPAC name is 6-fluoro-2-methyl-N'-naphthalen-2-ylsulfonyl-3-phenylbenzohydrazide.
| Compound Name | 6-fluoro-2-methyl-N'-naphthalen-2-ylsulfonyl-3-phenylbenzohydrazide |
|---|---|
| PubChem CID | 134581276 |
| Molecular Formula | C24H19FN2O3S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 6-fluoro-2-methyl-N'-naphthalen-2-ylsulfonyl-3-phenylbenzohydrazide |
| SMILES | Cc1c(-c2ccccc2)ccc(F)c1C(=O)NNS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H19FN2O3S/c1-16-21(18-8-3-2-4-9-18)13-14-22(25)23(16)24(28)26-27-31(29,30)20-12-11-17-7-5-6-10-19(17)15-20/h2-15,27H,1H3,(H,26,28) |
| InChIKey | GUGNTBJSHAPHEA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|