C17H19FN2O3S — CID 134581392
6-fluoro-2-methyl-3-phenyl-N'-propan-2-ylsulfonylbenzohydrazide (PubChem CID 134581392) has the molecular formula C17H19FN2O3S and a molecular weight of 350.42 g/mol. Its IUPAC name is 6-fluoro-2-methyl-3-phenyl-N'-propan-2-ylsulfonylbenzohydrazide.
| Compound Name | 6-fluoro-2-methyl-3-phenyl-N'-propan-2-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 134581392 |
| Molecular Formula | C17H19FN2O3S |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 6-fluoro-2-methyl-3-phenyl-N'-propan-2-ylsulfonylbenzohydrazide |
| SMILES | Cc1c(-c2ccccc2)ccc(F)c1C(=O)NNS(=O)(=O)C(C)C |
| InChI | InChI=1S/C17H19FN2O3S/c1-11(2)24(22,23)20-19-17(21)16-12(3)14(9-10-15(16)18)13-7-5-4-6-8-13/h4-11,20H,1-3H3,(H,19,21) |
| InChIKey | QJXOGBWFIMUPST-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|