C20H15F2NO3S — CID 134581210
N-(benzenesulfonylmethyl)-2,6-difluoro-3-phenylbenzamide (PubChem CID 134581210) has the molecular formula C20H15F2NO3S and a molecular weight of 387.41 g/mol. Its IUPAC name is N-(benzenesulfonylmethyl)-2,6-difluoro-3-phenylbenzamide.
| Compound Name | N-(benzenesulfonylmethyl)-2,6-difluoro-3-phenylbenzamide |
|---|---|
| PubChem CID | 134581210 |
| Molecular Formula | C20H15F2NO3S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | N-(benzenesulfonylmethyl)-2,6-difluoro-3-phenylbenzamide |
| SMILES | O=C(NCS(=O)(=O)c1ccccc1)c1c(F)ccc(-c2ccccc2)c1F |
| InChI | InChI=1S/C20H15F2NO3S/c21-17-12-11-16(14-7-3-1-4-8-14)19(22)18(17)20(24)23-13-27(25,26)15-9-5-2-6-10-15/h1-12H,13H2,(H,23,24) |
| InChIKey | GJBVXLVNFUYUGB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |