About 7,9-dibromo-6-[(4-methoxy-3-propoxyphenyl)methyl]indolo[3,2-b]quinoxaline
7,9-dibromo-6-[(4-methoxy-3-propoxyphenyl)methyl]indolo[3,2-b]quinoxaline (PubChem CID 4730400) has the molecular formula C25H21Br2N3O2
and a molecular weight of 555.27 g/mol. Its IUPAC name is 7,9-dibromo-6-[(4-methoxy-3-propoxyphenyl)methyl]indolo[3,2-b]quinoxaline.
Molecular Properties
| Compound Name | 7,9-dibromo-6-[(4-methoxy-3-propoxyphenyl)methyl]indolo[3,2-b]quinoxaline |
| PubChem CID | 4730400 |
| Molecular Formula | C25H21Br2N3O2 |
| Molecular Weight | 555.27 g/mol |
| Exact Mass | 553.00 |
| IUPAC Name | 7,9-dibromo-6-[(4-methoxy-3-propoxyphenyl)methyl]indolo[3,2-b]quinoxaline |
| SMILES | CCCOc1cc(Cn2c3nc4ccccc4nc3c3cc(Br)cc(Br)c32)ccc1OC |
| InChI | InChI=1S/C25H21Br2N3O2/c1-3-10-32-22-11-15(8-9-21(22)31-2)14-30-24-17(12-16(26)13-18(24)27)23-25(30)29-20-7-5-4-6-19(20)28-23/h4-9,11-13H,3,10,14H2,1-2H3 |
| InChIKey | FZFJXXKCJZVTGK-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 555.27 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7,9-dibromo-6-[(4-methoxy-3-propoxyphenyl)methyl]indolo[3,2-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-dibromo-6-[(4-methoxy-3-propoxyphenyl)methyl]indolo[3,2-b]quinoxaline?
The IUPAC name of 7,9-dibromo-6-[(4-methoxy-3-propoxyphenyl)methyl]indolo[3,2-b]quinoxaline (CID 4730400) is 7,9-dibromo-6-[(4-methoxy-3-propoxyphenyl)methyl]indolo[3,2-b]quinoxaline.
What is the SMILES notation for 7,9-dibromo-6-[(4-methoxy-3-propoxyphenyl)methyl]indolo[3,2-b]quinoxaline?
The canonical SMILES for 7,9-dibromo-6-[(4-methoxy-3-propoxyphenyl)methyl]indolo[3,2-b]quinoxaline is CCCOc1cc(Cn2c3nc4ccccc4nc3c3cc(Br)cc(Br)c32)ccc1OC.
What is the InChIKey of 7,9-dibromo-6-[(4-methoxy-3-propoxyphenyl)methyl]indolo[3,2-b]quinoxaline?
The InChIKey is FZFJXXKCJZVTGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21Br2N3O2/c1-3-10-32-22-11-15(8-9-21(22)31-2)14-30-24-17(12-16(26)13-18(24)27)23-25(30)29-20-7-5-4-6-19(20)28-23/h4-9,11-13H,3,10,14H2,1-2H3.
What are the key properties of 7,9-dibromo-6-[(4-methoxy-3-propoxyphenyl)methyl]indolo[3,2-b]quinoxaline?
7,9-dibromo-6-[(4-methoxy-3-propoxyphenyl)methyl]indolo[3,2-b]quinoxaline has a molecular weight of 555.27 g/mol, XLogP of 7.11, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-dibromo-6-[(4-methoxy-3-propoxyphenyl)methyl]indolo[3,2-b]quinoxaline is sourced from PubChem (CID 4730400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).