C27H25Br2N3O2 — CID 4730404
7,9-dibromo-6-[(4-methoxy-3-pentoxyphenyl)methyl]indolo[3,2-b]quinoxaline (PubChem CID 4730404) has the molecular formula C27H25Br2N3O2 and a molecular weight of 583.32 g/mol. Its IUPAC name is 7,9-dibromo-6-[(4-methoxy-3-pentoxyphenyl)methyl]indolo[3,2-b]quinoxaline.
| Compound Name | 7,9-dibromo-6-[(4-methoxy-3-pentoxyphenyl)methyl]indolo[3,2-b]quinoxaline |
|---|---|
| PubChem CID | 4730404 |
| Molecular Formula | C27H25Br2N3O2 |
| Molecular Weight | 583.32 g/mol |
| Exact Mass | 581.03 |
| IUPAC Name | 7,9-dibromo-6-[(4-methoxy-3-pentoxyphenyl)methyl]indolo[3,2-b]quinoxaline |
| SMILES | CCCCCOc1cc(Cn2c3nc4ccccc4nc3c3cc(Br)cc(Br)c32)ccc1OC |
| InChI | InChI=1S/C27H25Br2N3O2/c1-3-4-7-12-34-24-13-17(10-11-23(24)33-2)16-32-26-19(14-18(28)15-20(26)29)25-27(32)31-22-9-6-5-8-21(22)30-25/h5-6,8-11,13-15H,3-4,7,12,16H2,1-2H3 |
| InChIKey | NCLNHWCWMMUZHB-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.32 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|