C15H14Cl2N2O4S2 — CID 4730911
methyl 2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4730911) has the molecular formula C15H14Cl2N2O4S2 and a molecular weight of 421.33 g/mol. Its IUPAC name is methyl 2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4730911 |
| Molecular Formula | C15H14Cl2N2O4S2 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 419.98 |
| IUPAC Name | methyl 2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NS(=O)(=O)c2cnc(Cl)c(Cl)c2)sc2c1CCCC2 |
| InChI | InChI=1S/C15H14Cl2N2O4S2/c1-23-15(20)12-9-4-2-3-5-11(9)24-14(12)19-25(21,22)8-6-10(16)13(17)18-7-8/h6-7,19H,2-5H2,1H3 |
| InChIKey | QQTHYGDWXZPAHN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|