C13H14N4O3 — CID 47335003
N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-2H-triazole-4-carboxamide (PubChem CID 47335003) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-2H-triazole-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 47335003 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-2H-triazole-4-carboxamide |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C13H14N4O3/c1-2-17(13(18)10-6-14-16-15-10)7-9-3-4-11-12(5-9)20-8-19-11/h3-6H,2,7-8H2,1H3,(H,14,15,16) |
| InChIKey | OTHUKOWIXBOGPR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |